CAS 97438-03-4 appears in our catalog under these names: 1-(4-Chlorophenyl)-1h,4h,5h,6h,7h,8h-cyclohepta[c]pyrazole-3-carboxylic acid, 95%, 1-(4-Chlorophenyl)-1H,4H,5H,6H,7H,8H-cyclohepta(c)pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
1-(4-chlorophenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxylic acid (CAS 97438-03-4) is a chemical compound with the molecular formula C15H15ClN2O2 and a molecular weight of 290.74 g/mol. IUPAC name: 1-(4-chlorophenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxylic acid. InChIKey: QJXQZYAWDBLXFU-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN2O2 |
|---|---|
| Molecular weight | 290.74 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxylic acid |
| InChIKey | QJXQZYAWDBLXFU-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(CC1)N(N=C2C(=O)O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)