CAS 791798-50-0 appears in our catalog under these names: 3-Amino-4-chloro-n-(4-ethoxyphenyl)benzamide, 95%, 3–Amino–4–chloro–N–(4–ethoxyphenyl)benzamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg.
3-amino-4-chloro-N-(4-ethoxyphenyl)benzamide (CAS 791798-50-0) is a chemical compound with the molecular formula C15H15ClN2O2 and a molecular weight of 290.74 g/mol. IUPAC name: 3-amino-4-chloro-N-(4-ethoxyphenyl)benzamide. InChIKey: VQYQXXDLGCIRFZ-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN2O2 |
|---|---|
| Molecular weight | 290.74 g/mol |
| IUPAC name | 3-amino-4-chloro-N-(4-ethoxyphenyl)benzamide |
| InChIKey | VQYQXXDLGCIRFZ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)NC(=O)C2=CC(=C(C=C2)Cl)N |
Computed by PubChem (NCBI)