CAS 6312-48-7 is the registry number for 2-Chloro-3-(4-methylpiperazino)naphthoquinone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-chloro-3-(4-methylpiperazin-1-yl)naphthalene-1,4-dione (CAS 6312-48-7) is a chemical compound with the molecular formula C15H15ClN2O2 and a molecular weight of 290.74 g/mol. IUPAC name: 2-chloro-3-(4-methylpiperazin-1-yl)naphthalene-1,4-dione. InChIKey: GUNUJEHGUYLPRR-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN2O2 |
|---|---|
| Molecular weight | 290.74 g/mol |
| IUPAC name | 2-chloro-3-(4-methylpiperazin-1-yl)naphthalene-1,4-dione |
| InChIKey | GUNUJEHGUYLPRR-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C(=O)C3=CC=CC=C3C2=O)Cl |
Computed by PubChem (NCBI)