CAS 37971-69-0 appears in our catalog under these names: 7–O–Methylaromadendrin, Aromadendrin 7-O-methyl ether. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 0,5mg, Get quote.
(2R,3R)-3,5-dihydroxy-2-(4-hydroxyphenyl)-7-methoxy-2,3-dihydrochromen-4-one (CAS 37971-69-0) is a chemical compound with the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. IUPAC name: (2R,3R)-3,5-dihydroxy-2-(4-hydroxyphenyl)-7-methoxy-2,3-dihydrochromen-4-one. InChIKey: LZLGHWHSUZVUFZ-JKSUJKDBSA-N.
| Molecular formula | C16H14O6 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | (2R,3R)-3,5-dihydroxy-2-(4-hydroxyphenyl)-7-methoxy-2,3-dihydrochromen-4-one |
| InChIKey | LZLGHWHSUZVUFZ-JKSUJKDBSA-N |
| SMILES | COC1=CC(=C2C(=C1)O[C@@H]([C@H](C2=O)O)C3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)