Products 379729-08-5
CAS 379729-08-5 appears in our catalog under these names: 4-(4-Fluoro-phenylsulfamoyl)-benzoic acid, 95%, 4-((4-Fluorophenyl)sulfamoyl)benzoic acid, 95%, 4-((4-Fluorophenyl)sulfamoyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
4-[(4-fluorophenyl)sulfamoyl]benzoic acid (CAS 379729-08-5) is a chemical compound with the molecular formula C13H10FNO4S and a molecular weight of 295.29 g/mol. IUPAC name: 4-[(4-fluorophenyl)sulfamoyl]benzoic acid. InChIKey: TXOQYCWPOYXFKW-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO4S |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | 4-[(4-fluorophenyl)sulfamoyl]benzoic acid |
| InChIKey | TXOQYCWPOYXFKW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)S(=O)(=O)NC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)