Products 612041-67-5

CAS 612041-67-5 is the registry number for 4-(((2-Fluorophenyl)sulfonyl)amino)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-[(2-fluorophenyl)sulfonylamino]benzoic acid (CAS 612041-67-5) is a chemical compound with the molecular formula C13H10FNO4S and a molecular weight of 295.29 g/mol. IUPAC name: 4-[(2-fluorophenyl)sulfonylamino]benzoic acid. InChIKey: HADUKEXPXYPMIY-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10FNO4S
Molecular weight295.29 g/mol
IUPAC name4-[(2-fluorophenyl)sulfonylamino]benzoic acid
InChIKeyHADUKEXPXYPMIY-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)F)S(=O)(=O)NC2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)