Products 885269-80-7

CAS 885269-80-7 is the registry number for 3-(3-Fluorophenylsulfonamido)benzoic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g, 10g, 1g.

3-[(3-fluorophenyl)sulfonylamino]benzoic acid (CAS 885269-80-7) is a chemical compound with the molecular formula C13H10FNO4S and a molecular weight of 295.29 g/mol. IUPAC name: 3-[(3-fluorophenyl)sulfonylamino]benzoic acid. InChIKey: NVLPATGVMWNAHA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10FNO4S
Molecular weight295.29 g/mol
IUPAC name3-[(3-fluorophenyl)sulfonylamino]benzoic acid
InChIKeyNVLPATGVMWNAHA-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)NS(=O)(=O)C2=CC=CC(=C2)F)C(=O)O

Computed by PubChem (NCBI)