CAS 392313-12-1 appears in our catalog under these names: 4-(4-Fluoro-benzenesulfonylamino)-benzoic acid, 95%, 4-(4-FLUORO-BENZENESULFONYLAMINO)-BENZOIC ACID, 97%, 97%, 4-(4-Fluorobenzenesulfonamido)benzoic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
4-[(4-fluorophenyl)sulfonylamino]benzoic acid (CAS 392313-12-1) is a chemical compound with the molecular formula C13H10FNO4S and a molecular weight of 295.29 g/mol. IUPAC name: 4-[(4-fluorophenyl)sulfonylamino]benzoic acid. InChIKey: JZAGNXODGTUSSL-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO4S |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | 4-[(4-fluorophenyl)sulfonylamino]benzoic acid |
| InChIKey | JZAGNXODGTUSSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)NS(=O)(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)