CAS 38028-40-9 is the registry number for trans-5,6-Dihydrodihydroxynaphthol, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 25mg.
(1S,2S)-1,2-dihydronaphthalene-1,2,5-triol (CAS 38028-40-9) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: (1S,2S)-1,2-dihydronaphthalene-1,2,5-triol. InChIKey: SGLWVPNWAVTUMD-UWVGGRQHSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | (1S,2S)-1,2-dihydronaphthalene-1,2,5-triol |
| InChIKey | SGLWVPNWAVTUMD-UWVGGRQHSA-N |
| SMILES | C1=CC2=C(C=C[C@@H]([C@H]2O)O)C(=C1)O |
Computed by PubChem (NCBI)