CAS 5536-39-0 is the registry number for 5,6-Dihydro-5,6-dihydroxynaphthol. Offered by: Dr. Ehrenstorfer. Available pack sizes: 10mg.
1,2-dihydronaphthalene-1,2,5-triol (CAS 5536-39-0) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 1,2-dihydronaphthalene-1,2,5-triol. InChIKey: SGLWVPNWAVTUMD-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 1,2-dihydronaphthalene-1,2,5-triol |
| InChIKey | SGLWVPNWAVTUMD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(C2O)O)C(=C1)O |
Computed by PubChem (NCBI)