Products 39607-90-4
CAS 39607-90-4 is the registry number for 3-Chloro-10,11-dihydro-5H-dibenzo(B,D)azepine. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg.
3-chloro-10,11-dihydro-5H-benzo[d][1]benzazepine (CAS 39607-90-4) is a chemical compound with the molecular formula C14H12ClN and a molecular weight of 229.70 g/mol. IUPAC name: 3-chloro-10,11-dihydro-5H-benzo[d][1]benzazepine. InChIKey: QKINVOHDBKGPHN-UHFFFAOYSA-N.
| Molecular formula | C14H12ClN |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | 3-chloro-10,11-dihydro-5H-benzo[d][1]benzazepine |
| InChIKey | QKINVOHDBKGPHN-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C1)C=CNC3=C2C=CC(=C3)Cl |
Computed by PubChem (NCBI)