Products 38129-46-3

CAS 38129-46-3 is the registry number for Fentanyl Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 3-[(3-methoxy-3-oxopropyl)-(2-phenylethyl)amino]propanoate (CAS 38129-46-3) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: methyl 3-[(3-methoxy-3-oxopropyl)-(2-phenylethyl)amino]propanoate. InChIKey: COAZEEYMKFNOMN-UHFFFAOYSA-N.

Identity
Molecular formulaC16H23NO4
Molecular weight293.36 g/mol
IUPAC namemethyl 3-[(3-methoxy-3-oxopropyl)-(2-phenylethyl)amino]propanoate
InChIKeyCOAZEEYMKFNOMN-UHFFFAOYSA-N
SMILESCOC(=O)CCN(CCC1=CC=CC=C1)CCC(=O)OC

Computed by PubChem (NCBI)