Products 38146-79-1
CAS 38146-79-1 appears in our catalog under these names: 8，9–Dehydrothymol isobutyrate, 8,9-Dehydrothymol isobutyrate. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 50mg, 25mg, Get quote.
(5-methyl-2-prop-1-en-2-ylphenyl) 2-methylpropanoate (CAS 38146-79-1) is a chemical compound with the molecular formula C14H18O2 and a molecular weight of 218.29 g/mol. IUPAC name: (5-methyl-2-prop-1-en-2-ylphenyl) 2-methylpropanoate. InChIKey: BSAPRZRKFYAPEB-UHFFFAOYSA-N.
| Molecular formula | C14H18O2 |
|---|---|
| Molecular weight | 218.29 g/mol |
| IUPAC name | (5-methyl-2-prop-1-en-2-ylphenyl) 2-methylpropanoate |
| InChIKey | BSAPRZRKFYAPEB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=C)C)OC(=O)C(C)C |
Computed by PubChem (NCBI)