Products 38313-48-3
CAS 38313-48-3 appears in our catalog under these names: 3',5'-Anhydrothymidine, 3'，5'–Anhydrothymidine, 3',5'-Anhydrothymidine, 98%, 2,5'-Anhydro-thymidine. Offered by: Chemat Brand, GLPBio, AmBeed, Biosynth. Available pack sizes: on request, 1g, 250mg.
1-[(1R,3R,5S)-2,6-dioxabicyclo[3.2.0]heptan-3-yl]-5-methylpyrimidine-2,4-dione (CAS 38313-48-3) is a chemical compound with the molecular formula C10H12N2O4 and a molecular weight of 224.21 g/mol. IUPAC name: 1-[(1R,3R,5S)-2,6-dioxabicyclo[3.2.0]heptan-3-yl]-5-methylpyrimidine-2,4-dione. InChIKey: OAWLMYIJZBBZTP-XLPZGREQSA-N.
| Molecular formula | C10H12N2O4 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 1-[(1R,3R,5S)-2,6-dioxabicyclo[3.2.0]heptan-3-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | OAWLMYIJZBBZTP-XLPZGREQSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C[C@H]3[C@H](O2)CO3 |
Computed by PubChem (NCBI)