Products 383132-27-2
CAS 383132-27-2 appears in our catalog under these names: 4,6-Dimethyl-1H-indole-2-carboxylic acid, 98%, 4,6-Dimethyl-1H-indole-2-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 5g, 10g, 1g, 25g, 250mg, 100mg.
4,6-dimethyl-1H-indole-2-carboxylic acid (CAS 383132-27-2) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 4,6-dimethyl-1H-indole-2-carboxylic acid. InChIKey: HRHYVQGVACIBPS-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 4,6-dimethyl-1H-indole-2-carboxylic acid |
| InChIKey | HRHYVQGVACIBPS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(NC2=C1)C(=O)O)C |
Computed by PubChem (NCBI)