Products 3833-78-1
CAS 3833-78-1 appears in our catalog under these names: 7-(Trifluoromethyl)quinazoline-2,4(1h,3h)-dione, 95%, 7-(Trifluoromethyl)quinazoline-2,4(1H,3H)-dione, 95-<97%. Offered by: Combi-blocks, Hoffman Fine Chemicals. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g.
7-(trifluoromethyl)-1H-quinazoline-2,4-dione (CAS 3833-78-1) is a chemical compound with the molecular formula C9H5F3N2O2 and a molecular weight of 230.14 g/mol. IUPAC name: 7-(trifluoromethyl)-1H-quinazoline-2,4-dione. InChIKey: OWKQLTBXMVNRAI-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O2 |
|---|---|
| Molecular weight | 230.14 g/mol |
| IUPAC name | 7-(trifluoromethyl)-1H-quinazoline-2,4-dione |
| InChIKey | OWKQLTBXMVNRAI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)NC(=O)NC2=O |
Computed by PubChem (NCBI)