Products 38396-89-3
CAS 38396-89-3 appears in our catalog under these names: Alpha-bromo-3'-acetoxyacetophenone, 2-Bromo-3'-acetyloxylacetophenone, 2–Bromo–3'–acetyloxylacetophenone, Noradrenaline (Norepinephrine) Impurity 54, Salbutamol Impurity 65. Offered by: Chemat Brand, TRC, GLPBio, Hubei YoungXin, Chemat. Available pack sizes: on request, 100mg, 10mg, 25mg, 50mg, 200mg, 250mg, 1g.
[3-(2-bromoacetyl)phenyl] acetate (CAS 38396-89-3) is a chemical compound with the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. IUPAC name: [3-(2-bromoacetyl)phenyl] acetate. InChIKey: YLJZSPJKMBFLRA-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO3 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | [3-(2-bromoacetyl)phenyl] acetate |
| InChIKey | YLJZSPJKMBFLRA-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC(=C1)C(=O)CBr |
Computed by PubChem (NCBI)