CAS 38560-96-2 is the registry number for 2-Chloro-1,3-dimethyl-5-nitrobenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
2-chloro-1,3-dimethyl-5-nitrobenzene (CAS 38560-96-2) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 2-chloro-1,3-dimethyl-5-nitrobenzene. InChIKey: XOTLSEJRAUKAPO-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 2-chloro-1,3-dimethyl-5-nitrobenzene |
| InChIKey | XOTLSEJRAUKAPO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Cl)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)