CAS 38589-95-6 appears in our catalog under these names: (S)-Isopropyl 2-amino-3-(4-hydroxyphenyl)propanoate hydrochloride, 95%, Isopropyl l-tyrosinate hydrochloride, 98%, 98%, Isopropyl l-tyrosinate hydrochloride, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g.
Propan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride (CAS 38589-95-6) is a chemical compound with the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. IUPAC name: propan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride. InChIKey: MBEDQTSSCGSNGS-MERQFXBCSA-N.
| Molecular formula | C12H18ClNO3 |
|---|---|
| Molecular weight | 259.73 g/mol |
| IUPAC name | propan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride |
| InChIKey | MBEDQTSSCGSNGS-MERQFXBCSA-N |
| SMILES | CC(C)OC(=O)[C@H](CC1=CC=C(C=C1)O)N.Cl |
Computed by PubChem (NCBI)