Products 386730-25-2

CAS 386730-25-2 is the registry number for 2-Pentyl-1,3-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-pentyl-1,3-thiazole-4-carboxylic acid (CAS 386730-25-2) is a chemical compound with the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. IUPAC name: 2-pentyl-1,3-thiazole-4-carboxylic acid. InChIKey: MHVIMKREDSFNGW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13NO2S
Molecular weight199.27 g/mol
IUPAC name2-pentyl-1,3-thiazole-4-carboxylic acid
InChIKeyMHVIMKREDSFNGW-UHFFFAOYSA-N
SMILESCCCCCC1=NC(=CS1)C(=O)O

Computed by PubChem (NCBI)