CAS 38681-76-4 appears in our catalog under these names: N-Isopropyl-4-nitrobenzamide, 97%, N-Isopropyl-4-nitrobenzamide, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 1g, 5g.
4-nitro-N-propan-2-ylbenzamide (CAS 38681-76-4) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: 4-nitro-N-propan-2-ylbenzamide. InChIKey: YQLNAYKZWIVHIN-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 4-nitro-N-propan-2-ylbenzamide |
| InChIKey | YQLNAYKZWIVHIN-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)