Products 387358-52-3
CAS 387358-52-3 appears in our catalog under these names: 5-(2-Bromophenyl)-1,2-oxazole, 95%, 5-(2-Bromophenyl)isoxazole 97%, 5-(2-Bromophenyl)isoxazole, 97%, 97%, 5-(2-Bromophenyl)isoxazole. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
5-(2-bromophenyl)-1,2-oxazole (CAS 387358-52-3) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 5-(2-bromophenyl)-1,2-oxazole. InChIKey: CFIWXQDRNFECMZ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 5-(2-bromophenyl)-1,2-oxazole |
| InChIKey | CFIWXQDRNFECMZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=NO2)Br |
Computed by PubChem (NCBI)