Products 387825-03-8
CAS 387825-03-8 is the registry number for 4-(4-Chloro-2-hydroxybenzamido)butanoic acid, 98%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 1g, 5g, 25g.
4-[(4-chloro-2-hydroxybenzoyl)amino]butanoic acid (CAS 387825-03-8) is a chemical compound with the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. IUPAC name: 4-[(4-chloro-2-hydroxybenzoyl)amino]butanoic acid. InChIKey: GCVGCXMTCJMBHY-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO4 |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | 4-[(4-chloro-2-hydroxybenzoyl)amino]butanoic acid |
| InChIKey | GCVGCXMTCJMBHY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)O)C(=O)NCCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Salclobuzic Acid, Salclobuzic Acid [INN], acido salclobuzico, acide salclobuzique, 4-[(4-chloro-2-hydroxybenzoyl)amino]butanoic acid, Butanoic acid, 4-[(4-chloro-2-hydroxybenzoyl)amino]-, acidum salclobuzicum, 4-(4-chloro-2-hydroxybenzamido)butanoic acid, 4-[(4-chloro-2-hydroxy-benzoyl)amino]butanoic Acid, GCVGCXMTCJMBHY-UHFFFAOYSA-N