CAS 38854-94-3 appears in our catalog under these names: (R)-1-Benzyl-5-carboxy-2-pyrrolidinone, 95%, Bzl-D-Pyr-OH 98%, (R)-1-Benzyl-5-carboxy-2-pyrrolidinone, 98%, 98%, (R)-1-BENZYL-5-OXOPYRROLIDINE-2-CARBOXYLIC ACID. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
(2R)-1-benzyl-5-oxopyrrolidine-2-carboxylic acid (CAS 38854-94-3) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: (2R)-1-benzyl-5-oxopyrrolidine-2-carboxylic acid. InChIKey: MOHLVDJRXGVGOM-SNVBAGLBSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | (2R)-1-benzyl-5-oxopyrrolidine-2-carboxylic acid |
| InChIKey | MOHLVDJRXGVGOM-SNVBAGLBSA-N |
| SMILES | C1CC(=O)N([C@H]1C(=O)O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)