CAS 38879-46-8 is the registry number for (Z)-4-Benzylidene-2-methyloxazol-5(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(4Z)-4-benzylidene-2-methyl-1,3-oxazol-5-one (CAS 38879-46-8) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: (4Z)-4-benzylidene-2-methyl-1,3-oxazol-5-one. InChIKey: BWQBTJRPSDVWIR-YFHOEESVSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | (4Z)-4-benzylidene-2-methyl-1,3-oxazol-5-one |
| InChIKey | BWQBTJRPSDVWIR-YFHOEESVSA-N |
| SMILES | CC1=N/C(=C\C2=CC=CC=C2)/C(=O)O1 |
Computed by PubChem (NCBI)