CAS 389131-94-6 appears in our catalog under these names: 4–Azidobutanol 1–(4–Methylbenzenesulfonate), 4-Azidobutyl 4-methylbenzenesulfonate, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 250mg, 100mg, 1g.
4-azidobutyl 4-methylbenzenesulfonate (CAS 389131-94-6) is a chemical compound with the molecular formula C11H15N3O3S and a molecular weight of 269.32 g/mol. IUPAC name: 4-azidobutyl 4-methylbenzenesulfonate. InChIKey: VCNIVVPLEIFWQJ-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O3S |
|---|---|
| Molecular weight | 269.32 g/mol |
| IUPAC name | 4-azidobutyl 4-methylbenzenesulfonate |
| InChIKey | VCNIVVPLEIFWQJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)