Products 38970-49-9
CAS 38970-49-9 is the registry number for Tschimganin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-hydroxy-3-methoxybenzoate (CAS 38970-49-9) is a chemical compound with the molecular formula C18H24O4 and a molecular weight of 304.4 g/mol. IUPAC name: (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-hydroxy-3-methoxybenzoate. InChIKey: KTOAGBIQQPGNIR-UHFFFAOYSA-N.
| Molecular formula | C18H24O4 |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-hydroxy-3-methoxybenzoate |
| InChIKey | KTOAGBIQQPGNIR-UHFFFAOYSA-N |
| SMILES | CC1(C2CCC1(C(C2)OC(=O)C3=CC(=C(C=C3)O)OC)C)C |
Computed by PubChem (NCBI)