CAS 39035-14-8 is the registry number for (5aR,5bS,7aS,8R,10aS,10bR)–8–Ethynyl–5a,7a–dimethyl–3–phenyl–3,4,5,5a,5b,6,7,7a,8,9,10,10a,10b,11–tetradecahydrocyclopenta(5,6)naphtho(2,1–e)indazol–8–ol. Offered by: GLPBio. Available pack sizes: 5g.
2-hydroxy-4-nitrobenzonitrile (CAS 39035-14-8) is a chemical compound with the molecular formula C7H4N2O3 and a molecular weight of 164.12 g/mol. IUPAC name: 2-hydroxy-4-nitrobenzonitrile. InChIKey: DZNPHVPBCNZVGW-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 2-hydroxy-4-nitrobenzonitrile |
| InChIKey | DZNPHVPBCNZVGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])O)C#N |
Computed by PubChem (NCBI)