CAS 39053-79-7 is the registry number for 2-(1,3-Dioxaindan-5-yl)-2-methylpropanenitrile. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(1,3-benzodioxol-5-yl)-2-methylpropanenitrile (CAS 39053-79-7) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)-2-methylpropanenitrile. InChIKey: CBBJHDSNBQSHIN-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)-2-methylpropanenitrile |
| InChIKey | CBBJHDSNBQSHIN-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C1=CC2=C(C=C1)OCO2 |
Computed by PubChem (NCBI)