CAS 39077-18-4 is the registry number for 2,6-Dimethoxy-1-nitronaphthalene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-dimethoxy-1-nitronaphthalene (CAS 39077-18-4) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 2,6-dimethoxy-1-nitronaphthalene. InChIKey: GGJRYBJPEQHCMK-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 2,6-dimethoxy-1-nitronaphthalene |
| InChIKey | GGJRYBJPEQHCMK-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=C(C=C2)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)