Products 39096-80-5
CAS 39096-80-5 is the registry number for 2,2-Dichloro-N-(1-phenylethyl)acetamide, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,2-dichloro-N-(1-phenylethyl)acetamide (CAS 39096-80-5) is a chemical compound with the molecular formula C10H11Cl2NO and a molecular weight of 232.10 g/mol. IUPAC name: 2,2-dichloro-N-(1-phenylethyl)acetamide. InChIKey: OKVKOBMHKRIIOW-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO |
|---|---|
| Molecular weight | 232.10 g/mol |
| IUPAC name | 2,2-dichloro-N-(1-phenylethyl)acetamide |
| InChIKey | OKVKOBMHKRIIOW-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)NC(=O)C(Cl)Cl |
Computed by PubChem (NCBI)