CAS 39139-79-2 is the registry number for N,N-Dimethyl-2,4-dinitro-1-naphthalenamine. Offered by: TRC. Available pack sizes: 250mg, 25mg.
N,N-dimethyl-2,4-dinitronaphthalen-1-amine (CAS 39139-79-2) is a chemical compound with the molecular formula C12H11N3O4 and a molecular weight of 261.23 g/mol. IUPAC name: N,N-dimethyl-2,4-dinitronaphthalen-1-amine. InChIKey: RHMRIRCVYOVJRE-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O4 |
|---|---|
| Molecular weight | 261.23 g/mol |
| IUPAC name | N,N-dimethyl-2,4-dinitronaphthalen-1-amine |
| InChIKey | RHMRIRCVYOVJRE-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C2=CC=CC=C21)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)