CAS 3916-40-3 is the registry number for N-Phthaloylglycylglycine. Offered by: TRC. Available pack sizes: 50mg.
2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]acetic acid (CAS 3916-40-3) is a chemical compound with the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. IUPAC name: 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]acetic acid. InChIKey: GGZCEFKSVHSZHT-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O5 |
|---|---|
| Molecular weight | 262.22 g/mol |
| IUPAC name | 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]acetic acid |
| InChIKey | GGZCEFKSVHSZHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC(=O)NCC(=O)O |
Computed by PubChem (NCBI)