CAS 391649-79-9 is the registry number for 3-benzo(3,4-d)1,3-dioxolen-5-yl-2-(2,2-dimethylpropanoyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg, 2000mg, 5000mg.
2-(1,3-benzodioxol-5-ylmethylidene)-4,4-dimethyl-3-oxopentanenitrile (CAS 391649-79-9) is a chemical compound with the molecular formula C15H15NO3 and a molecular weight of 257.28 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-ylmethylidene)-4,4-dimethyl-3-oxopentanenitrile. InChIKey: GWIBXULMGOBDGK-UHFFFAOYSA-N.
| Molecular formula | C15H15NO3 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-ylmethylidene)-4,4-dimethyl-3-oxopentanenitrile |
| InChIKey | GWIBXULMGOBDGK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C(=CC1=CC2=C(C=C1)OCO2)C#N |
Computed by PubChem (NCBI)