CAS 391649-81-3 is the registry number for 2-(2,2-dimethylpropanoyl)-3-(3-nitrophenyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 1g, 2g.
(2E)-4,4-dimethyl-2-[(3-nitrophenyl)methylidene]-3-oxopentanenitrile (CAS 391649-81-3) is a chemical compound with the molecular formula C14H14N2O3 and a molecular weight of 258.27 g/mol. IUPAC name: (2E)-4,4-dimethyl-2-[(3-nitrophenyl)methylidene]-3-oxopentanenitrile. InChIKey: ZUXVIFYCMLLURE-YRNVUSSQSA-N.
| Molecular formula | C14H14N2O3 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | (2E)-4,4-dimethyl-2-[(3-nitrophenyl)methylidene]-3-oxopentanenitrile |
| InChIKey | ZUXVIFYCMLLURE-YRNVUSSQSA-N |
| SMILES | CC(C)(C)C(=O)/C(=C/C1=CC(=CC=C1)[N+](=O)[O-])/C#N |
Computed by PubChem (NCBI)