Products 391682-51-2
CAS 391682-51-2 appears in our catalog under these names: (E)–Cinnamyl–(Z)–p–coumarate, (E)-Cinnamyl-(Z)-p-coumarate. Offered by: GLPBio, Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
[(E)-3-phenylprop-2-enyl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate (CAS 391682-51-2) is a chemical compound with the molecular formula C18H16O3 and a molecular weight of 280.3 g/mol. IUPAC name: [(E)-3-phenylprop-2-enyl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate. InChIKey: JDBSEUVQZVQSCN-AHGNYBSDSA-N.
| Molecular formula | C18H16O3 |
|---|---|
| Molecular weight | 280.3 g/mol |
| IUPAC name | [(E)-3-phenylprop-2-enyl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate |
| InChIKey | JDBSEUVQZVQSCN-AHGNYBSDSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/COC(=O)/C=C\C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)