CAS 3917-41-7 appears in our catalog under these names: (2E,4E)-3-Methyl-5-(2,6,6-trimethylcyclohex-1-en-1-yl)penta-2,4-dienal, 98%, (7E,9E)-b-Ionylidene Acetaldehyde Technical grade (>85%), (7E,9E)-beta-Ionylidene Acetaldehyde. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg, 25mg, 500mg.
(2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienal (CAS 3917-41-7) is a chemical compound with the molecular formula C15H22O and a molecular weight of 218.33 g/mol. IUPAC name: (2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienal. InChIKey: OPSSCPNCFKJCFR-ANKZSMJWSA-N.
| Molecular formula | C15H22O |
|---|---|
| Molecular weight | 218.33 g/mol |
| IUPAC name | (2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienal |
| InChIKey | OPSSCPNCFKJCFR-ANKZSMJWSA-N |
| SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=O)/C |
Computed by PubChem (NCBI)