CAS 54226-17-4 is the registry number for (7E,9Z)-beta-Ionylidene Acetaldehyde. Offered by: Chemat Brand. Available pack sizes: on request.
(2Z,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienal (CAS 54226-17-4) is a chemical compound with the molecular formula C15H22O and a molecular weight of 218.33 g/mol. IUPAC name: (2Z,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienal. InChIKey: OPSSCPNCFKJCFR-GHYOLMRSSA-N.
| Molecular formula | C15H22O |
|---|---|
| Molecular weight | 218.33 g/mol |
| IUPAC name | (2Z,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienal |
| InChIKey | OPSSCPNCFKJCFR-GHYOLMRSSA-N |
| SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C\C=O)/C |
Computed by PubChem (NCBI)