CAS 39181-54-9 is the registry number for 5-((3-Fluorophenyl)methyl)-1,3,4-thiadiazol-2-amine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
5-[(3-fluorophenyl)methyl]-1,3,4-thiadiazol-2-amine (CAS 39181-54-9) is a chemical compound with the molecular formula C9H8FN3S and a molecular weight of 209.25 g/mol. IUPAC name: 5-[(3-fluorophenyl)methyl]-1,3,4-thiadiazol-2-amine. InChIKey: GVGKHZZMJYTPKV-UHFFFAOYSA-N.
| Molecular formula | C9H8FN3S |
|---|---|
| Molecular weight | 209.25 g/mol |
| IUPAC name | 5-[(3-fluorophenyl)methyl]-1,3,4-thiadiazol-2-amine |
| InChIKey | GVGKHZZMJYTPKV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CC2=NN=C(S2)N |
Computed by PubChem (NCBI)