CAS 39269-10-8 appears in our catalog under these names: 1,3-Adamantanedicarboxylic acid, >95% (HPLC), 1,3–Adamantanedicarboxylic Acid, Adamantane-1,3-dicarboxylic acid, 98% , 1,3-Adamantanedicarboxylic Acid, >97.0%(GC)(T), Adamantane-1,3-dicarboxylic acid 97%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 100g, 25g, 1g, 5g, 10g.
Adamantane-1,3-dicarboxylic acid (CAS 39269-10-8) is a chemical compound with the molecular formula C12H16O4 and a molecular weight of 224.25 g/mol. IUPAC name: adamantane-1,3-dicarboxylic acid. InChIKey: PAVQGHWQOQZQEH-UHFFFAOYSA-N.
| Molecular formula | C12H16O4 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | adamantane-1,3-dicarboxylic acid |
| InChIKey | PAVQGHWQOQZQEH-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)