CAS 39275-18-8 appears in our catalog under these names: 1-Methyl-7-nitro-1,2,3,4-tetrahydroquinoline, 95-<97%, 1-Methyl-7-nitro-1,2,3,4-tetrahydroquinoline, ≥97-<99%, 1-Methyl-7-nitro-1,2,3,4-tetrahydroquinoline, 98%, 98%, 1-Methyl-7-nitro-1,2,3,4-tetrahydroquinoline, 98%. Offered by: Hoffman Fine Chemicals, Chemat, Fluorochem. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 100mg, 250mg.
1-methyl-7-nitro-3,4-dihydro-2H-quinoline (CAS 39275-18-8) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. IUPAC name: 1-methyl-7-nitro-3,4-dihydro-2H-quinoline. InChIKey: UIQYGCGBKBKFJY-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 1-methyl-7-nitro-3,4-dihydro-2H-quinoline |
| InChIKey | UIQYGCGBKBKFJY-UHFFFAOYSA-N |
| SMILES | CN1CCCC2=C1C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)