CAS 394203-55-5 appears in our catalog under these names: 1-(2-Bromophenyl)-2,2,2-trifluoroethanol, 95%, 1–(2–Bromophenyl)–2,2,2–trifluoroethanol, 1-(2-Bromophenyl)-2,2,2-trifluoroethanol, 98%, 98%, 1-(2-Bromophenyl)-2,2,2-trifluoroethanol, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 1g.
1-(2-bromophenyl)-2,2,2-trifluoroethanol (CAS 394203-55-5) is a chemical compound with the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. IUPAC name: 1-(2-bromophenyl)-2,2,2-trifluoroethanol. InChIKey: AHNQGLQRPWGSLD-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | 1-(2-bromophenyl)-2,2,2-trifluoroethanol |
| InChIKey | AHNQGLQRPWGSLD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(F)(F)F)O)Br |
Computed by PubChem (NCBI)