CAS 3956-34-1 appears in our catalog under these names: Methyl 4-amino-2,6-dimethoxybenzoate 98%, methyl 4-amino-2,6-dimethoxybenzoate, 98%, 98%, Methyl 4-amino-2,6-dimethoxybenzoate, 99.71%, Methyl 4-amino-2,6-dimethoxybenzoate, 98%. Offered by: Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 250 mg, 100 mg, 500 mg, 1 g.
Methyl 4-amino-2,6-dimethoxybenzoate (CAS 3956-34-1) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: methyl 4-amino-2,6-dimethoxybenzoate. InChIKey: ULKQAFJENDMZMB-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | methyl 4-amino-2,6-dimethoxybenzoate |
| InChIKey | ULKQAFJENDMZMB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1C(=O)OC)OC)N |
Computed by PubChem (NCBI)