CAS 3964-18-9 appears in our catalog under these names: 2,3–Dimethyl–2,3–dinitrobutane, 2,3-Dimethyl-2,3-dinitrobutane, >98.0%(GC), 2,3-DIMETHYL-2,3-DINITROBUTANE, 98%. Offered by: GLPBio, TCI, Sigma-Aldrich. Available pack sizes: 100g, 10g, 25g, 5g, 50G.
2,3-dimethyl-2,3-dinitrobutane (CAS 3964-18-9) is a chemical compound with the molecular formula C6H12N2O4 and a molecular weight of 176.17 g/mol. IUPAC name: 2,3-dimethyl-2,3-dinitrobutane. InChIKey: DWCLXOREGBLXTD-UHFFFAOYSA-N.
| Molecular formula | C6H12N2O4 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 2,3-dimethyl-2,3-dinitrobutane |
| InChIKey | DWCLXOREGBLXTD-UHFFFAOYSA-N |
| SMILES | CC(C)(C(C)(C)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)