CAS 39652-34-1 appears in our catalog under these names: 3,5–Dichloro–4–methylbenzoic acid, 3,5-Dichloro-4-methylbenzoic acid 98%, 3,5-Dichloro-4-methylbenzoic acid, 98%, 98%, 3,5-Dichloro-4-methylbenzoic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 500g, 250mg, 1g, 10g, 50g.
3,5-dichloro-4-methylbenzoic acid (CAS 39652-34-1) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 3,5-dichloro-4-methylbenzoic acid. InChIKey: GBEJAEMDMASLJL-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 3,5-dichloro-4-methylbenzoic acid |
| InChIKey | GBEJAEMDMASLJL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)