Products 39701-13-8

CAS 39701-13-8 is the registry number for 2′,4′,6′-Trimethoxy-3′-methylacetophenone. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 1 mg.

Structural formula: {0} (CAS {1})

1-(2,4,6-trimethoxy-3-methylphenyl)ethanone (CAS 39701-13-8) is a chemical compound with the molecular formula C12H16O4 and a molecular weight of 224.25 g/mol. IUPAC name: 1-(2,4,6-trimethoxy-3-methylphenyl)ethanone. InChIKey: JUWLMMHIOBSJSI-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O4
Molecular weight224.25 g/mol
IUPAC name1-(2,4,6-trimethoxy-3-methylphenyl)ethanone
InChIKeyJUWLMMHIOBSJSI-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1OC)OC)C(=O)C)OC

Computed by PubChem (NCBI)