CAS 39773-50-7 is the registry number for 6-(4-Bromophenyl)-1,3-diazinane-2,4-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(4-bromophenyl)-1,3-diazinane-2,4-dione (CAS 39773-50-7) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: 6-(4-bromophenyl)-1,3-diazinane-2,4-dione. InChIKey: RKCJUOTXNIQTOX-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | 6-(4-bromophenyl)-1,3-diazinane-2,4-dione |
| InChIKey | RKCJUOTXNIQTOX-UHFFFAOYSA-N |
| SMILES | C1C(NC(=O)NC1=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)