CAS 39786-40-8 appears in our catalog under these names: 4–Chloro–2–methylbenzofuro(3,2–d)pyrimidine, 4-chloro-2-MethylbenzofuropyriMidine, 97%, 97%, 4-Chloro-2-methylbenzofuro[3,2-d]pyrimidine, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 100g, 100mg, 250mg, 5g.
4-chloro-2-methyl-[1]benzofuro[3,2-d]pyrimidine (CAS 39786-40-8) is a chemical compound with the molecular formula C11H7ClN2O and a molecular weight of 218.64 g/mol. IUPAC name: 4-chloro-2-methyl-[1]benzofuro[3,2-d]pyrimidine. InChIKey: GXGXMTZNONDUMY-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2O |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 4-chloro-2-methyl-[1]benzofuro[3,2-d]pyrimidine |
| InChIKey | GXGXMTZNONDUMY-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=N1)Cl)OC3=CC=CC=C32 |
Computed by PubChem (NCBI)