Products 39829-15-7
CAS 39829-15-7 is the registry number for Methyl 3-(3,4-dimethoxyphenyl)-2-oxiranecarboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 3-(3,4-dimethoxyphenyl)oxirane-2-carboxylate (CAS 39829-15-7) is a chemical compound with the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. IUPAC name: methyl 3-(3,4-dimethoxyphenyl)oxirane-2-carboxylate. InChIKey: TVJWKSMUDASVSJ-UHFFFAOYSA-N.
| Molecular formula | C12H14O5 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | methyl 3-(3,4-dimethoxyphenyl)oxirane-2-carboxylate |
| InChIKey | TVJWKSMUDASVSJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2C(O2)C(=O)OC)OC |
Computed by PubChem (NCBI)