CAS 39897-13-7 appears in our catalog under these names: (S)-1-Tosylazetidine-2-carboxylic acid, 97%, (S)–1–Tosylazetidine–2–carboxylic acid. Offered by: AmBeed, GLPBio. Available pack sizes: 100mg, 250mg.
(2S)-1-(4-methylphenyl)sulfonylazetidine-2-carboxylic acid (CAS 39897-13-7) is a chemical compound with the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. IUPAC name: (2S)-1-(4-methylphenyl)sulfonylazetidine-2-carboxylic acid. InChIKey: PCZMDMOEFYSSGY-JTQLQIEISA-N.
| Molecular formula | C11H13NO4S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | (2S)-1-(4-methylphenyl)sulfonylazetidine-2-carboxylic acid |
| InChIKey | PCZMDMOEFYSSGY-JTQLQIEISA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC[C@H]2C(=O)O |
Computed by PubChem (NCBI)